C13H18F6O2 — CID 59217559
[1,1,1-trifluoro-2-methyl-2-(trifluoromethyl)hexan-3-yl] 2-methylidenebutanoate (PubChem CID 59217559) has the molecular formula C13H18F6O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-methyl-2-(trifluoromethyl)hexan-3-yl] 2-methylidenebutanoate.
| Compound Name | [1,1,1-trifluoro-2-methyl-2-(trifluoromethyl)hexan-3-yl] 2-methylidenebutanoate |
|---|---|
| PubChem CID | 59217559 |
| Molecular Formula | C13H18F6O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [1,1,1-trifluoro-2-methyl-2-(trifluoromethyl)hexan-3-yl] 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OC(CCC)C(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H18F6O2/c1-5-7-9(21-10(20)8(3)6-2)11(4,12(14,15)16)13(17,18)19/h9H,3,5-7H2,1-2,4H3 |
| InChIKey | ADPQTZSJRGCALN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|