C12H25NO6S — CID 153465464
azanium [3,4-dimethyl-5-(2-methylprop-2-enoyloxy)hexan-3-yl] sulfate (PubChem CID 153465464) has the molecular formula C12H25NO6S and a molecular weight of 311.40 g/mol. Its IUPAC name is azanium [3,4-dimethyl-5-(2-methylprop-2-enoyloxy)hexan-3-yl] sulfate.
| Compound Name | azanium [3,4-dimethyl-5-(2-methylprop-2-enoyloxy)hexan-3-yl] sulfate |
|---|---|
| PubChem CID | 153465464 |
| Molecular Formula | C12H25NO6S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | azanium [3,4-dimethyl-5-(2-methylprop-2-enoyloxy)hexan-3-yl] sulfate |
| SMILES | C=C(C)C(=O)OC(C)C(C)C(C)(CC)OS(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C12H22O6S.H3N/c1-7-12(6,18-19(14,15)16)9(4)10(5)17-11(13)8(2)3;/h9-10H,2,7H2,1,3-6H3,(H,14,15,16);1H3 |
| InChIKey | ZDLKVUOWOFNADH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|