C16H14F24O4Si2 — CID 123809046
[3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,2,2-trifluoro-2-(1-fluoro-3-silylpropoxy)ethoxy]ethoxy]propoxy]butyl]-bis(trifluoromethyl)silane (PubChem CID 123809046) has the molecular formula C16H14F24O4Si2 and a molecular weight of 782.41 g/mol. Its IUPAC name is [3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,2,2-trifluoro-2-(1-fluoro-3-silylpropoxy)ethoxy]ethoxy]propoxy]butyl]-bis(trifluoromethyl)silane.
| Compound Name | [3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,2,2-trifluoro-2-(1-fluoro-3-silylpropoxy)ethoxy]ethoxy]propoxy]butyl]-bis(trifluoromethyl)silane |
|---|---|
| PubChem CID | 123809046 |
| Molecular Formula | C16H14F24O4Si2 |
| Molecular Weight | 782.41 g/mol |
| Exact Mass | 782.00 |
| IUPAC Name | [3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,2,2-trifluoro-2-(1-fluoro-3-silylpropoxy)ethoxy]ethoxy]propoxy]butyl]-bis(trifluoromethyl)silane |
| SMILES | FC(CC[SiH3])OC(F)(F)C(F)OC(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(CC[SiH](C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H14F24O4Si2/c17-5(1-3-45)41-8(20,21)6(18)42-13(31,32)14(33,34)44-9(22,11(26,27)28)12(29,30)43-7(19,10(23,24)25)2-4-46(15(35,36)37)16(38,39)40/h5-6,46H,1-4H2,45H3 |
| InChIKey | HXVBJSJXEXTYOM-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.41 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|