C9HF17O2S — CID 154358166
2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)hexanethioic S-acid (PubChem CID 154358166) has the molecular formula C9HF17O2S and a molecular weight of 496.14 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)hexanethioic S-acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)hexanethioic S-acid |
|---|---|
| PubChem CID | 154358166 |
| Molecular Formula | C9HF17O2S |
| Molecular Weight | 496.14 g/mol |
| Exact Mass | 495.94 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)hexanethioic S-acid |
| SMILES | O=C(S)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9HF17O2S/c10-2(11,1(27)29)3(12,13)4(14,15)5(16,17)9(25,26)28-6(18,7(19,20)21)8(22,23)24/h(H,27,29) |
| InChIKey | MEIRQFPDBNGTMI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.14 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|