C8HF13O4 — CID 139831264
3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propoxy]-2-oxobutanoic acid (PubChem CID 139831264) has the molecular formula C8HF13O4 and a molecular weight of 408.07 g/mol. Its IUPAC name is 3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propoxy]-2-oxobutanoic acid.
| Compound Name | 3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propoxy]-2-oxobutanoic acid |
|---|---|
| PubChem CID | 139831264 |
| Molecular Formula | C8HF13O4 |
| Molecular Weight | 408.07 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | 3,4,4,4-tetrafluoro-3-[1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propoxy]-2-oxobutanoic acid |
| SMILES | O=C(O)C(=O)C(F)(OC(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8HF13O4/c9-3(5(11,12)13,1(22)2(23)24)25-8(20,21)4(10,6(14,15)16)7(17,18)19/h(H,23,24) |
| InChIKey | JHOSQCPJFFMQIC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.07 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|