C10H4F18O2 — CID 134451384
1,1,2,2,3,3,4,4-octafluoro-5-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]pentane (PubChem CID 134451384) has the molecular formula C10H4F18O2 and a molecular weight of 498.10 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-5-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]pentane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-5-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]pentane |
|---|---|
| PubChem CID | 134451384 |
| Molecular Formula | C10H4F18O2 |
| Molecular Weight | 498.10 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-5-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]pentane |
| SMILES | FC(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H4F18O2/c11-2(12)5(16,17)7(20,21)4(14,15)1-29-6(18,19)3(13)30-10(27,28)8(22,23)9(24,25)26/h2-3H,1H2 |
| InChIKey | HWVAZCULRUGPCV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.10 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|