C10H3F19O — CID 175759806
1,1,1,2,2,3,3,4,4,5,6,6-dodecafluoro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)hexane (PubChem CID 175759806) has the molecular formula C10H3F19O and a molecular weight of 500.10 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,6,6-dodecafluoro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)hexane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,6,6-dodecafluoro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)hexane |
|---|---|
| PubChem CID | 175759806 |
| Molecular Formula | C10H3F19O |
| Molecular Weight | 500.10 g/mol |
| Exact Mass | 499.99 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,6,6-dodecafluoro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)hexane |
| SMILES | FC(C(F)(F)OCC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H3F19O/c11-2(4(14,15)7(20,21)8(22,23)10(27,28)29)5(16,17)30-1-3(12,13)6(18,19)9(24,25)26/h2H,1H2 |
| InChIKey | ROSUGUUUZSJBIJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.10 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|