C7H4F12O — CID 88558529
1,1,1,2,2,3,3-heptafluoro-4-(1,2,3,3,3-pentafluoropropoxy)butane (PubChem CID 88558529) has the molecular formula C7H4F12O and a molecular weight of 332.08 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-4-(1,2,3,3,3-pentafluoropropoxy)butane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-4-(1,2,3,3,3-pentafluoropropoxy)butane |
|---|---|
| PubChem CID | 88558529 |
| Molecular Formula | C7H4F12O |
| Molecular Weight | 332.08 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-4-(1,2,3,3,3-pentafluoropropoxy)butane |
| SMILES | FC(OCC(F)(F)C(F)(F)C(F)(F)F)C(F)C(F)(F)F |
| InChI | InChI=1S/C7H4F12O/c8-2(5(12,13)14)3(9)20-1-4(10,11)6(15,16)7(17,18)19/h2-3H,1H2 |
| InChIKey | CYANHUACHRXBLR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.08 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|