About 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane
3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane (PubChem CID 58114504) has the molecular formula C6H7F7O
and a molecular weight of 228.11 g/mol. Its IUPAC name is 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane.
Analyze 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane?
The IUPAC name of 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane (CID 58114504) is 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane.
What is the SMILES notation for 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane?
The canonical SMILES for 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane is CC(F)(F)COC(F)C(F)C(F)(F)F.
What is the InChIKey of 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane?
The InChIKey is YWHVPKIYBNFGPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F7O/c1-5(9,10)2-14-4(8)3(7)6(11,12)13/h3-4H,2H2,1H3.
What are the key properties of 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane?
3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane has a molecular weight of 228.11 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoropropoxy)-1,1,1,2,3-pentafluoropropane is sourced from PubChem (CID 58114504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).