C5H5F7O — CID 57200862
1,1,1,2,4,4,4-heptafluoro-3-methoxybutane (PubChem CID 57200862) has the molecular formula C5H5F7O and a molecular weight of 214.08 g/mol. Its IUPAC name is 1,1,1,2,4,4,4-heptafluoro-3-methoxybutane.
| Compound Name | 1,1,1,2,4,4,4-heptafluoro-3-methoxybutane |
|---|---|
| PubChem CID | 57200862 |
| Molecular Formula | C5H5F7O |
| Molecular Weight | 214.08 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 1,1,1,2,4,4,4-heptafluoro-3-methoxybutane |
| SMILES | COC(C(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H5F7O/c1-13-3(5(10,11)12)2(6)4(7,8)9/h2-3H,1H3 |
| InChIKey | XYGGEJNNMWWHGP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.08 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |