C8H6F8O7 — CID 102362717
2-[2-[2-(carboxymethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]acetic acid (PubChem CID 102362717) has the molecular formula C8H6F8O7 and a molecular weight of 366.11 g/mol. Its IUPAC name is 2-[2-[2-(carboxymethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]acetic acid.
| Compound Name | 2-[2-[2-(carboxymethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]acetic acid |
|---|---|
| PubChem CID | 102362717 |
| Molecular Formula | C8H6F8O7 |
| Molecular Weight | 366.11 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-[2-[2-(carboxymethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]acetic acid |
| SMILES | O=C(O)COC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OCC(=O)O |
| InChI | InChI=1S/C8H6F8O7/c9-5(10,21-1-3(17)18)7(13,14)23-8(15,16)6(11,12)22-2-4(19)20/h1-2H2,(H,17,18)(H,19,20) |
| InChIKey | OYVHLPQTLWSEBM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.11 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|