C7H14N2O4 — CID 87272054
3-[(3-amino-3-oxopropoxy)methoxy]propanamide (PubChem CID 87272054) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-[(3-amino-3-oxopropoxy)methoxy]propanamide.
| Compound Name | 3-[(3-amino-3-oxopropoxy)methoxy]propanamide |
|---|---|
| PubChem CID | 87272054 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3-[(3-amino-3-oxopropoxy)methoxy]propanamide |
| SMILES | NC(=O)CCOCOCCC(N)=O |
| InChI | InChI=1S/C7H14N2O4/c8-6(10)1-3-12-5-13-4-2-7(9)11/h1-5H2,(H2,8,10)(H2,9,11) |
| InChIKey | PSKHHAMJJHNJJD-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|