C15H28N2O6 — CID 167044215
3-[2-[(3-amino-3-oxopropoxy)methyl]-2-methyl-3-(3-oxobutoxy)propoxy]propanamide (PubChem CID 167044215) has the molecular formula C15H28N2O6 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-[2-[(3-amino-3-oxopropoxy)methyl]-2-methyl-3-(3-oxobutoxy)propoxy]propanamide.
| Compound Name | 3-[2-[(3-amino-3-oxopropoxy)methyl]-2-methyl-3-(3-oxobutoxy)propoxy]propanamide |
|---|---|
| PubChem CID | 167044215 |
| Molecular Formula | C15H28N2O6 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 3-[2-[(3-amino-3-oxopropoxy)methyl]-2-methyl-3-(3-oxobutoxy)propoxy]propanamide |
| SMILES | CC(=O)CCOCC(C)(COCCC(N)=O)COCCC(N)=O |
| InChI | InChI=1S/C15H28N2O6/c1-12(18)3-6-21-9-15(2,10-22-7-4-13(16)19)11-23-8-5-14(17)20/h3-11H2,1-2H3,(H2,16,19)(H2,17,20) |
| InChIKey | FOMYLPKQKOAUNZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|