C7H8F8O — CID 88558628
1,1,1-trifluoro-4-(1,1,3,3,3-pentafluoropropoxy)butane (PubChem CID 88558628) has the molecular formula C7H8F8O and a molecular weight of 260.12 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(1,1,3,3,3-pentafluoropropoxy)butane.
| Compound Name | 1,1,1-trifluoro-4-(1,1,3,3,3-pentafluoropropoxy)butane |
|---|---|
| PubChem CID | 88558628 |
| Molecular Formula | C7H8F8O |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1,1,1-trifluoro-4-(1,1,3,3,3-pentafluoropropoxy)butane |
| SMILES | FC(F)(F)CCCOC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C7H8F8O/c8-5(9,10)2-1-3-16-7(14,15)4-6(11,12)13/h1-4H2 |
| InChIKey | MNQVQSDWCFTURM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|