C7H8BrF6NO — CID 103311032
N-(1-bromopropan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide (PubChem CID 103311032) has the molecular formula C7H8BrF6NO and a molecular weight of 316.04 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide.
| Compound Name | N-(1-bromopropan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 103311032 |
| Molecular Formula | C7H8BrF6NO |
| Molecular Weight | 316.04 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | N-(1-bromopropan-2-yl)-3,3,3-trifluoro-2-(trifluoromethyl)propanamide |
| SMILES | CC(CBr)NC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8BrF6NO/c1-3(2-8)15-5(16)4(6(9,10)11)7(12,13)14/h3-4H,2H2,1H3,(H,15,16) |
| InChIKey | LERZSRRUIFZTOG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.04 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|