C12H13Br2F2NO2 — CID 106244885
4-bromo-N-(3-bromo-4-methoxybutyl)-2,6-difluorobenzamide (PubChem CID 106244885) has the molecular formula C12H13Br2F2NO2 and a molecular weight of 401.05 g/mol. Its IUPAC name is 4-bromo-N-(3-bromo-4-methoxybutyl)-2,6-difluorobenzamide.
| Compound Name | 4-bromo-N-(3-bromo-4-methoxybutyl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 106244885 |
| Molecular Formula | C12H13Br2F2NO2 |
| Molecular Weight | 401.05 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | 4-bromo-N-(3-bromo-4-methoxybutyl)-2,6-difluorobenzamide |
| SMILES | COCC(Br)CCNC(=O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H13Br2F2NO2/c1-19-6-7(13)2-3-17-12(18)11-9(15)4-8(14)5-10(11)16/h4-5,7H,2-3,6H2,1H3,(H,17,18) |
| InChIKey | PXEMNRNFVDGVSO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.05 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|