C13H21ClF3NO2 — CID 106155078
N-(4-chloro-1-methoxybutan-2-yl)-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 106155078) has the molecular formula C13H21ClF3NO2 and a molecular weight of 315.76 g/mol. Its IUPAC name is N-(4-chloro-1-methoxybutan-2-yl)-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(4-chloro-1-methoxybutan-2-yl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106155078 |
| Molecular Formula | C13H21ClF3NO2 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(4-chloro-1-methoxybutan-2-yl)-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | COCC(CCCl)NC(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H21ClF3NO2/c1-20-8-11(5-6-14)18-12(19)9-3-2-4-10(7-9)13(15,16)17/h9-11H,2-8H2,1H3,(H,18,19) |
| InChIKey | HPXDFKDRNQQVTH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|