C15H28BrNO — CID 114149740
N-(5-bromo-2,2-dimethylpentyl)-4-methylcyclohexane-1-carboxamide (PubChem CID 114149740) has the molecular formula C15H28BrNO and a molecular weight of 318.30 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-4-methylcyclohexane-1-carboxamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114149740 |
| Molecular Formula | C15H28BrNO |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-4-methylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(=O)NCC(C)(C)CCCBr)CC1 |
| InChI | InChI=1S/C15H28BrNO/c1-12-5-7-13(8-6-12)14(18)17-11-15(2,3)9-4-10-16/h12-13H,4-11H2,1-3H3,(H,17,18) |
| InChIKey | QUUWQUOSVUGDOY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|