C11H20BrNOS — CID 106143446
N-(4-bromo-2,2-dimethylbutyl)thiolane-3-carboxamide (PubChem CID 106143446) has the molecular formula C11H20BrNOS and a molecular weight of 294.26 g/mol. Its IUPAC name is N-(4-bromo-2,2-dimethylbutyl)thiolane-3-carboxamide.
| Compound Name | N-(4-bromo-2,2-dimethylbutyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 106143446 |
| Molecular Formula | C11H20BrNOS |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | N-(4-bromo-2,2-dimethylbutyl)thiolane-3-carboxamide |
| SMILES | CC(C)(CCBr)CNC(=O)C1CCSC1 |
| InChI | InChI=1S/C11H20BrNOS/c1-11(2,4-5-12)8-13-10(14)9-3-6-15-7-9/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | RTHJKQZUGSRZCO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|