C13H24BrNO2 — CID 106143568
N-(4-bromo-2,2-dimethylbutyl)-2-ethyloxolane-3-carboxamide (PubChem CID 106143568) has the molecular formula C13H24BrNO2 and a molecular weight of 306.24 g/mol. Its IUPAC name is N-(4-bromo-2,2-dimethylbutyl)-2-ethyloxolane-3-carboxamide.
| Compound Name | N-(4-bromo-2,2-dimethylbutyl)-2-ethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 106143568 |
| Molecular Formula | C13H24BrNO2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-(4-bromo-2,2-dimethylbutyl)-2-ethyloxolane-3-carboxamide |
| SMILES | CCC1OCCC1C(=O)NCC(C)(C)CCBr |
| InChI | InChI=1S/C13H24BrNO2/c1-4-11-10(5-8-17-11)12(16)15-9-13(2,3)6-7-14/h10-11H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | SAFQGKPEMLOTBX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|