C13H26ClNO — CID 106144319
N-(5-chloro-2,2-dimethylpentyl)-2-ethylbutanamide (PubChem CID 106144319) has the molecular formula C13H26ClNO and a molecular weight of 247.81 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-2-ethylbutanamide.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-2-ethylbutanamide |
|---|---|
| PubChem CID | 106144319 |
| Molecular Formula | C13H26ClNO |
| Molecular Weight | 247.81 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCC(C)(C)CCCCl |
| InChI | InChI=1S/C13H26ClNO/c1-5-11(6-2)12(16)15-10-13(3,4)8-7-9-14/h11H,5-10H2,1-4H3,(H,15,16) |
| InChIKey | IFKKDYONAVFRFJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.81 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|