C34H64N2O7 — CID 176797629
6-[[5-(5,5-dimethylhexoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]hexyl 4,4-dimethylpentyl carbonate (PubChem CID 176797629) has the molecular formula C34H64N2O7 and a molecular weight of 612.89 g/mol. Its IUPAC name is 6-[[5-(5,5-dimethylhexoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]hexyl 4,4-dimethylpentyl carbonate.
| Compound Name | 6-[[5-(5,5-dimethylhexoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]hexyl 4,4-dimethylpentyl carbonate |
|---|---|
| PubChem CID | 176797629 |
| Molecular Formula | C34H64N2O7 |
| Molecular Weight | 612.89 g/mol |
| Exact Mass | 612.47 |
| IUPAC Name | 6-[[5-(5,5-dimethylhexoxycarbonylamino)-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]hexyl 4,4-dimethylpentyl carbonate |
| SMILES | CC(C)(C)CCCCOC(=O)NC1CC(C)(C)CC(C)(CNC(=O)OCCCCCCOC(=O)OCCCC(C)(C)C)C1 |
| InChI | InChI=1S/C34H64N2O7/c1-31(2,3)17-12-15-20-41-29(38)36-27-23-33(7,8)25-34(9,24-27)26-35-28(37)40-19-13-10-11-14-21-42-30(39)43-22-16-18-32(4,5)6/h27H,10-26H2,1-9H3,(H,35,37)(H,36,38) |
| InChIKey | SADFXOMJBLESBU-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.89 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|