C25H31F15N2O4 — CID 88898560
2,2,3,3,4,4,5,5-octafluoropentyl N-[4-[[4-(2,2,3,3,4,4,5-heptafluoropentoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate (PubChem CID 88898560) has the molecular formula C25H31F15N2O4 and a molecular weight of 708.50 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl N-[4-[[4-(2,2,3,3,4,4,5-heptafluoropentoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl N-[4-[[4-(2,2,3,3,4,4,5-heptafluoropentoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 88898560 |
| Molecular Formula | C25H31F15N2O4 |
| Molecular Weight | 708.50 g/mol |
| Exact Mass | 708.20 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl N-[4-[[4-(2,2,3,3,4,4,5-heptafluoropentoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCC(CC2CCC(NC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)CC2)CC1)OCC(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C25H31F15N2O4/c26-10-20(29,30)24(37,38)21(31,32)11-45-18(43)41-15-5-1-13(2-6-15)9-14-3-7-16(8-4-14)42-19(44)46-12-22(33,34)25(39,40)23(35,36)17(27)28/h13-17H,1-12H2,(H,41,43)(H,42,44) |
| InChIKey | KLGFACACDMEDQH-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.50 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|