C15H28N4O4 — CID 126490326
amino N-[4-[[4-(aminooxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate (PubChem CID 126490326) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is amino N-[4-[[4-(aminooxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate.
| Compound Name | amino N-[4-[[4-(aminooxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 126490326 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | amino N-[4-[[4-(aminooxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamate |
| SMILES | NOC(=O)NC1CCC(CC2CCC(NC(=O)ON)CC2)CC1 |
| InChI | InChI=1S/C15H28N4O4/c16-22-14(20)18-12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)19-15(21)23-17/h10-13H,1-9,16-17H2,(H,18,20)(H,19,21) |
| InChIKey | RDTOGQUGMZBTAA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|