C21H34N2O6 — CID 154976396
4-[[4-[[4-(methoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamoyloxy]-2-methylidenebutanoic acid (PubChem CID 154976396) has the molecular formula C21H34N2O6 and a molecular weight of 410.51 g/mol. Its IUPAC name is 4-[[4-[[4-(methoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamoyloxy]-2-methylidenebutanoic acid.
| Compound Name | 4-[[4-[[4-(methoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamoyloxy]-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 154976396 |
| Molecular Formula | C21H34N2O6 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 4-[[4-[[4-(methoxycarbonylamino)cyclohexyl]methyl]cyclohexyl]carbamoyloxy]-2-methylidenebutanoic acid |
| SMILES | C=C(CCOC(=O)NC1CCC(CC2CCC(NC(=O)OC)CC2)CC1)C(=O)O |
| InChI | InChI=1S/C21H34N2O6/c1-14(19(24)25)11-12-29-21(27)23-18-9-5-16(6-10-18)13-15-3-7-17(8-4-15)22-20(26)28-2/h15-18H,1,3-13H2,2H3,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | WTOPNOCAYZMWDF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|