C42H72N2O8 — CID 159322941
4-methoxybutyl 2-[4-[[4-[2-[4-[[4-[(4-acetamidocyclohexyl)methyl]cyclohexyl]carbamoyloxy]butoxy]-2-oxoethyl]cyclohexyl]methyl]cyclohexyl]acetate (PubChem CID 159322941) has the molecular formula C42H72N2O8 and a molecular weight of 733.04 g/mol. Its IUPAC name is 4-methoxybutyl 2-[4-[[4-[2-[4-[[4-[(4-acetamidocyclohexyl)methyl]cyclohexyl]carbamoyloxy]butoxy]-2-oxoethyl]cyclohexyl]methyl]cyclohexyl]acetate.
| Compound Name | 4-methoxybutyl 2-[4-[[4-[2-[4-[[4-[(4-acetamidocyclohexyl)methyl]cyclohexyl]carbamoyloxy]butoxy]-2-oxoethyl]cyclohexyl]methyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 159322941 |
| Molecular Formula | C42H72N2O8 |
| Molecular Weight | 733.04 g/mol |
| Exact Mass | 732.53 |
| IUPAC Name | 4-methoxybutyl 2-[4-[[4-[2-[4-[[4-[(4-acetamidocyclohexyl)methyl]cyclohexyl]carbamoyloxy]butoxy]-2-oxoethyl]cyclohexyl]methyl]cyclohexyl]acetate |
| SMILES | COCCCCOC(=O)CC1CCC(CC2CCC(CC(=O)OCCCCOC(=O)NC3CCC(CC4CCC(NC(C)=O)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C42H72N2O8/c1-31(45)43-38-19-15-34(16-20-38)28-35-17-21-39(22-18-35)44-42(48)52-26-6-5-25-51-41(47)30-37-13-9-33(10-14-37)27-32-7-11-36(12-8-32)29-40(46)50-24-4-3-23-49-2/h32-39H,3-30H2,1-2H3,(H,43,45)(H,44,48) |
| InChIKey | FALTVSKZUSGRHN-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.04 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|