C22H42N2O5 — CID 91098128
ethyl N-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]carbamate;4-hydroxybutyl acetate (PubChem CID 91098128) has the molecular formula C22H42N2O5 and a molecular weight of 414.59 g/mol. Its IUPAC name is ethyl N-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]carbamate;4-hydroxybutyl acetate.
| Compound Name | ethyl N-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]carbamate;4-hydroxybutyl acetate |
|---|---|
| PubChem CID | 91098128 |
| Molecular Formula | C22H42N2O5 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | ethyl N-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]carbamate;4-hydroxybutyl acetate |
| SMILES | CC(=O)OCCCCO.CCOC(=O)NC1CCC(CC2CCC(N)CC2)CC1 |
| InChI | InChI=1S/C16H30N2O2.C6H12O3/c1-2-20-16(19)18-15-9-5-13(6-10-15)11-12-3-7-14(17)8-4-12;1-6(8)9-5-3-2-4-7/h12-15H,2-11,17H2,1H3,(H,18,19);7H,2-5H2,1H3 |
| InChIKey | LCWJYZOCTFTFSE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|