C24H46N2O2 — CID 71191343
2-(dibutylamino)ethyl N-[4-(cyclohexylmethyl)cyclohexyl]carbamate (PubChem CID 71191343) has the molecular formula C24H46N2O2 and a molecular weight of 394.64 g/mol. Its IUPAC name is 2-(dibutylamino)ethyl N-[4-(cyclohexylmethyl)cyclohexyl]carbamate.
| Compound Name | 2-(dibutylamino)ethyl N-[4-(cyclohexylmethyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 71191343 |
| Molecular Formula | C24H46N2O2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | 2-(dibutylamino)ethyl N-[4-(cyclohexylmethyl)cyclohexyl]carbamate |
| SMILES | CCCCN(CCCC)CCOC(=O)NC1CCC(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C24H46N2O2/c1-3-5-16-26(17-6-4-2)18-19-28-24(27)25-23-14-12-22(13-15-23)20-21-10-8-7-9-11-21/h21-23H,3-20H2,1-2H3,(H,25,27) |
| InChIKey | IAKPOPMZRZABOW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |