C24H44N2O5SSi — CID 58592229
3-[[3,3,5-trimethyl-5-[(3-trimethylsilylpropylsulfanylcarbonylamino)methyl]cyclohexyl]carbamoyloxy]propyl prop-2-enoate (PubChem CID 58592229) has the molecular formula C24H44N2O5SSi and a molecular weight of 500.78 g/mol. Its IUPAC name is 3-[[3,3,5-trimethyl-5-[(3-trimethylsilylpropylsulfanylcarbonylamino)methyl]cyclohexyl]carbamoyloxy]propyl prop-2-enoate.
| Compound Name | 3-[[3,3,5-trimethyl-5-[(3-trimethylsilylpropylsulfanylcarbonylamino)methyl]cyclohexyl]carbamoyloxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 58592229 |
| Molecular Formula | C24H44N2O5SSi |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 3-[[3,3,5-trimethyl-5-[(3-trimethylsilylpropylsulfanylcarbonylamino)methyl]cyclohexyl]carbamoyloxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOC(=O)NC1CC(C)(C)CC(C)(CNC(=O)SCCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C24H44N2O5SSi/c1-8-20(27)30-11-9-12-31-21(28)26-19-15-23(2,3)17-24(4,16-19)18-25-22(29)32-13-10-14-33(5,6)7/h8,19H,1,9-18H2,2-7H3,(H,25,29)(H,26,28) |
| InChIKey | HXTSGLSYOYHXDR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|