C19H30O7 — CID 59107244
prop-2-enoyloxymethyl 3-[5-[2-(hydroxymethoxy)-2-oxoethyl]-1,3,3-trimethylcyclohexyl]propanoate (PubChem CID 59107244) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is prop-2-enoyloxymethyl 3-[5-[2-(hydroxymethoxy)-2-oxoethyl]-1,3,3-trimethylcyclohexyl]propanoate.
| Compound Name | prop-2-enoyloxymethyl 3-[5-[2-(hydroxymethoxy)-2-oxoethyl]-1,3,3-trimethylcyclohexyl]propanoate |
|---|---|
| PubChem CID | 59107244 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | prop-2-enoyloxymethyl 3-[5-[2-(hydroxymethoxy)-2-oxoethyl]-1,3,3-trimethylcyclohexyl]propanoate |
| SMILES | C=CC(=O)OCOC(=O)CCC1(C)CC(CC(=O)OCO)CC(C)(C)C1 |
| InChI | InChI=1S/C19H30O7/c1-5-15(21)25-13-26-16(22)6-7-19(4)10-14(8-17(23)24-12-20)9-18(2,3)11-19/h5,14,20H,1,6-13H2,2-4H3 |
| InChIKey | PGWUNJYATAUGJZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|