C25H45N2O7P — CID 156541956
2-butoxyethyl N-[3,3,5-trimethyl-5-[[2-[methyl(2-methylprop-2-enoyl)phosphanyl]ethylperoxycarbonylamino]methyl]cyclohexyl]carbamate (PubChem CID 156541956) has the molecular formula C25H45N2O7P and a molecular weight of 516.62 g/mol. Its IUPAC name is 2-butoxyethyl N-[3,3,5-trimethyl-5-[[2-[methyl(2-methylprop-2-enoyl)phosphanyl]ethylperoxycarbonylamino]methyl]cyclohexyl]carbamate.
| Compound Name | 2-butoxyethyl N-[3,3,5-trimethyl-5-[[2-[methyl(2-methylprop-2-enoyl)phosphanyl]ethylperoxycarbonylamino]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 156541956 |
| Molecular Formula | C25H45N2O7P |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 2-butoxyethyl N-[3,3,5-trimethyl-5-[[2-[methyl(2-methylprop-2-enoyl)phosphanyl]ethylperoxycarbonylamino]methyl]cyclohexyl]carbamate |
| SMILES | C=C(C)C(=O)P(C)CCOOC(=O)NCC1(C)CC(NC(=O)OCCOCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C25H45N2O7P/c1-8-9-10-31-11-12-32-23(30)27-20-15-24(4,5)17-25(6,16-20)18-26-22(29)34-33-13-14-35(7)21(28)19(2)3/h20H,2,8-18H2,1,3-7H3,(H,26,29)(H,27,30) |
| InChIKey | VWCIFPWNFRPDOM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|