C32H62N2O2S2 — CID 118660514
O-decyl N-[3-[(decoxycarbothioylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamothioate (PubChem CID 118660514) has the molecular formula C32H62N2O2S2 and a molecular weight of 570.99 g/mol. Its IUPAC name is O-decyl N-[3-[(decoxycarbothioylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamothioate.
| Compound Name | O-decyl N-[3-[(decoxycarbothioylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamothioate |
|---|---|
| PubChem CID | 118660514 |
| Molecular Formula | C32H62N2O2S2 |
| Molecular Weight | 570.99 g/mol |
| Exact Mass | 570.43 |
| IUPAC Name | O-decyl N-[3-[(decoxycarbothioylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamothioate |
| SMILES | CCCCCCCCCCOC(=S)NCC1(C)CC(NC(=S)OCCCCCCCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C32H62N2O2S2/c1-6-8-10-12-14-16-18-20-22-35-29(37)33-27-32(5)25-28(24-31(3,4)26-32)34-30(38)36-23-21-19-17-15-13-11-9-7-2/h28H,6-27H2,1-5H3,(H,33,37)(H,34,38) |
| InChIKey | CLLJJLPQZWZFEM-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.99 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|