C24H44N4S2 — CID 101410739
1-cyclohexyl-3-[(1R,3S)-3-[(cyclohexylcarbamothioylamino)methyl]-3,5,5-trimethylcyclohexyl]thiourea (PubChem CID 101410739) has the molecular formula C24H44N4S2 and a molecular weight of 452.78 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1R,3S)-3-[(cyclohexylcarbamothioylamino)methyl]-3,5,5-trimethylcyclohexyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[(1R,3S)-3-[(cyclohexylcarbamothioylamino)methyl]-3,5,5-trimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 101410739 |
| Molecular Formula | C24H44N4S2 |
| Molecular Weight | 452.78 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 1-cyclohexyl-3-[(1R,3S)-3-[(cyclohexylcarbamothioylamino)methyl]-3,5,5-trimethylcyclohexyl]thiourea |
| SMILES | CC1(C)C[C@@H](NC(=S)NC2CCCCC2)C[C@@](C)(CNC(=S)NC2CCCCC2)C1 |
| InChI | InChI=1S/C24H44N4S2/c1-23(2)14-20(28-22(30)27-19-12-8-5-9-13-19)15-24(3,16-23)17-25-21(29)26-18-10-6-4-7-11-18/h18-20H,4-17H2,1-3H3,(H2,25,26,29)(H2,27,28,30)/t20-,24-/m1/s1 |
| InChIKey | WHXYJXZQDJDFKK-HYBUGGRVSA-N |
| XLogP | 5.16 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.78 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|