C15H29N3S — CID 103975342
1-cyclohexyl-3-[(1,4-dimethylpiperidin-4-yl)methyl]thiourea (PubChem CID 103975342) has the molecular formula C15H29N3S and a molecular weight of 283.48 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1,4-dimethylpiperidin-4-yl)methyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[(1,4-dimethylpiperidin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 103975342 |
| Molecular Formula | C15H29N3S |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 1-cyclohexyl-3-[(1,4-dimethylpiperidin-4-yl)methyl]thiourea |
| SMILES | CN1CCC(C)(CNC(=S)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C15H29N3S/c1-15(8-10-18(2)11-9-15)12-16-14(19)17-13-6-4-3-5-7-13/h13H,3-12H2,1-2H3,(H2,16,17,19) |
| InChIKey | YRGZWLQRCKPZLR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|