C14H28N4S — CID 115620804
1-cyclohexyl-3-[(1,4-dimethylpiperazin-2-yl)methyl]thiourea (PubChem CID 115620804) has the molecular formula C14H28N4S and a molecular weight of 284.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1,4-dimethylpiperazin-2-yl)methyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[(1,4-dimethylpiperazin-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 115620804 |
| Molecular Formula | C14H28N4S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1-cyclohexyl-3-[(1,4-dimethylpiperazin-2-yl)methyl]thiourea |
| SMILES | CN1CCN(C)C(CNC(=S)NC2CCCCC2)C1 |
| InChI | InChI=1S/C14H28N4S/c1-17-8-9-18(2)13(11-17)10-15-14(19)16-12-6-4-3-5-7-12/h12-13H,3-11H2,1-2H3,(H2,15,16,19) |
| InChIKey | RIGQWONCWZEORQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|