C12H26N4S — CID 113234145
1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-(2-methylpropyl)thiourea (PubChem CID 113234145) has the molecular formula C12H26N4S and a molecular weight of 258.43 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 113234145 |
| Molecular Formula | C12H26N4S |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)NCC1CN(C)CCN1C |
| InChI | InChI=1S/C12H26N4S/c1-10(2)7-13-12(17)14-8-11-9-15(3)5-6-16(11)4/h10-11H,5-9H2,1-4H3,(H2,13,14,17) |
| InChIKey | AGASVUNKBVLWCW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|