C18H38N6S2 — CID 102045401
1-propan-2-yl-3-[3-[4-[3-(propan-2-ylcarbamothioylamino)propyl]piperazin-1-yl]propyl]thiourea (PubChem CID 102045401) has the molecular formula C18H38N6S2 and a molecular weight of 402.68 g/mol. Its IUPAC name is 1-propan-2-yl-3-[3-[4-[3-(propan-2-ylcarbamothioylamino)propyl]piperazin-1-yl]propyl]thiourea.
| Compound Name | 1-propan-2-yl-3-[3-[4-[3-(propan-2-ylcarbamothioylamino)propyl]piperazin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 102045401 |
| Molecular Formula | C18H38N6S2 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1-propan-2-yl-3-[3-[4-[3-(propan-2-ylcarbamothioylamino)propyl]piperazin-1-yl]propyl]thiourea |
| SMILES | CC(C)NC(=S)NCCCN1CCN(CCCNC(=S)NC(C)C)CC1 |
| InChI | InChI=1S/C18H38N6S2/c1-15(2)21-17(25)19-7-5-9-23-11-13-24(14-12-23)10-6-8-20-18(26)22-16(3)4/h15-16H,5-14H2,1-4H3,(H2,19,21,25)(H2,20,22,26) |
| InChIKey | PEZWGGYSRIYHTM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|