C16H33ClN5S2- — CID 53350910
N-butyl-4-[2-(butylcarbamothioylamino)ethyl]piperazine-1-carbothioamide chloride (PubChem CID 53350910) has the molecular formula C16H33ClN5S2- and a molecular weight of 395.06 g/mol. Its IUPAC name is N-butyl-4-[2-(butylcarbamothioylamino)ethyl]piperazine-1-carbothioamide chloride.
| Compound Name | N-butyl-4-[2-(butylcarbamothioylamino)ethyl]piperazine-1-carbothioamide chloride |
|---|---|
| PubChem CID | 53350910 |
| Molecular Formula | C16H33ClN5S2- |
| Molecular Weight | 395.06 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-butyl-4-[2-(butylcarbamothioylamino)ethyl]piperazine-1-carbothioamide chloride |
| SMILES | CCCCNC(=S)NCCN1CCN(C(=S)NCCCC)CC1.[Cl-] |
| InChI | InChI=1S/C16H33N5S2.ClH/c1-3-5-7-17-15(22)18-9-10-20-11-13-21(14-12-20)16(23)19-8-6-4-2;/h3-14H2,1-2H3,(H,19,23)(H2,17,18,22);1H/p-1 |
| InChIKey | MFASRKOHDIRDNR-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.06 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|