C16H33N5S2 — CID 3364960
N-butyl-4-[2-(butylcarbamothioylamino)ethyl]piperazine-1-carbothioamide (PubChem CID 3364960) has the molecular formula C16H33N5S2 and a molecular weight of 359.61 g/mol. Its IUPAC name is N-butyl-4-[2-(butylcarbamothioylamino)ethyl]piperazine-1-carbothioamide.
| Compound Name | N-butyl-4-[2-(butylcarbamothioylamino)ethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3364960 |
| Molecular Formula | C16H33N5S2 |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-butyl-4-[2-(butylcarbamothioylamino)ethyl]piperazine-1-carbothioamide |
| SMILES | CCCCNC(=S)NCCN1CCN(C(=S)NCCCC)CC1 |
| InChI | InChI=1S/C16H33N5S2/c1-3-5-7-17-15(22)18-9-10-20-11-13-21(14-12-20)16(23)19-8-6-4-2/h3-14H2,1-2H3,(H,19,23)(H2,17,18,22) |
| InChIKey | MFUXKQKSHIXHKZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|