C12H25N3S — CID 103975349
1-[(1,4-dimethylpiperidin-4-yl)methyl]-3-propan-2-ylthiourea (PubChem CID 103975349) has the molecular formula C12H25N3S and a molecular weight of 243.42 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperidin-4-yl)methyl]-3-propan-2-ylthiourea.
| Compound Name | 1-[(1,4-dimethylpiperidin-4-yl)methyl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 103975349 |
| Molecular Formula | C12H25N3S |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-[(1,4-dimethylpiperidin-4-yl)methyl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NCC1(C)CCN(C)CC1 |
| InChI | InChI=1S/C12H25N3S/c1-10(2)14-11(16)13-9-12(3)5-7-15(4)8-6-12/h10H,5-9H2,1-4H3,(H2,13,14,16) |
| InChIKey | WQOXBUOOCVXTFX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|