C11H23N3O — CID 103993093
3-[(1,4-dimethylpiperidin-4-yl)methyl]-1,1-dimethylurea (PubChem CID 103993093) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[(1,4-dimethylpiperidin-4-yl)methyl]-1,1-dimethylurea.
| Compound Name | 3-[(1,4-dimethylpiperidin-4-yl)methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 103993093 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-[(1,4-dimethylpiperidin-4-yl)methyl]-1,1-dimethylurea |
| SMILES | CN1CCC(C)(CNC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C11H23N3O/c1-11(5-7-14(4)8-6-11)9-12-10(15)13(2)3/h5-9H2,1-4H3,(H,12,15) |
| InChIKey | IGNYAJIBPCEELZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |