About N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide
N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide (PubChem CID 131933559) has the molecular formula C13H27N3O2
and a molecular weight of 257.38 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide.
Molecular Properties
| Compound Name | N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide |
| PubChem CID | 131933559 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide |
| SMILES | COCCN(C)CC(=O)NCC1(C)CCN(C)C1 |
| InChI | InChI=1S/C13H27N3O2/c1-13(5-6-16(3)11-13)10-14-12(17)9-15(2)7-8-18-4/h5-11H2,1-4H3,(H,14,17) |
| InChIKey | UTKSACOVZGCEMP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide?
The IUPAC name of N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide (CID 131933559) is N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide.
What is the SMILES notation for N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide?
The canonical SMILES for N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide is COCCN(C)CC(=O)NCC1(C)CCN(C)C1.
What is the InChIKey of N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide?
The InChIKey is UTKSACOVZGCEMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2/c1-13(5-6-16(3)11-13)10-14-12(17)9-15(2)7-8-18-4/h5-11H2,1-4H3,(H,14,17).
What are the key properties of N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide?
N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide has a molecular weight of 257.38 g/mol, XLogP of 0.02, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-2-[2-methoxyethyl(methyl)amino]acetamide is sourced from PubChem (CID 131933559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).