C11H21ClN2O — CID 107163376
2-chloro-N-[(1,4-dimethylpiperidin-4-yl)methyl]propanamide (PubChem CID 107163376) has the molecular formula C11H21ClN2O and a molecular weight of 232.75 g/mol. Its IUPAC name is 2-chloro-N-[(1,4-dimethylpiperidin-4-yl)methyl]propanamide.
| Compound Name | 2-chloro-N-[(1,4-dimethylpiperidin-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 107163376 |
| Molecular Formula | C11H21ClN2O |
| Molecular Weight | 232.75 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-chloro-N-[(1,4-dimethylpiperidin-4-yl)methyl]propanamide |
| SMILES | CC(Cl)C(=O)NCC1(C)CCN(C)CC1 |
| InChI | InChI=1S/C11H21ClN2O/c1-9(12)10(15)13-8-11(2)4-6-14(3)7-5-11/h9H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | AQJCRVZECMWZRF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.75 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|