C13H26N4O2 — CID 107164956
N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-(N'-hydroxycarbamimidoyl)butanamide (PubChem CID 107164956) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-(N'-hydroxycarbamimidoyl)butanamide.
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-(N'-hydroxycarbamimidoyl)butanamide |
|---|---|
| PubChem CID | 107164956 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-(N'-hydroxycarbamimidoyl)butanamide |
| SMILES | CCC(C(=O)NCC1(C)CCN(C)CC1)C(N)=NO |
| InChI | InChI=1S/C13H26N4O2/c1-4-10(11(14)16-19)12(18)15-9-13(2)5-7-17(3)8-6-13/h10,19H,4-9H2,1-3H3,(H2,14,16)(H,15,18) |
| InChIKey | CJYSMVKCTFUBDB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|