C11H17N3O — CID 65362935
(3,4-dimethylcyclohexyl)-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 65362935) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl)-(1H-1,2,4-triazol-5-yl)methanone.
| Compound Name | (3,4-dimethylcyclohexyl)-(1H-1,2,4-triazol-5-yl)methanone |
|---|---|
| PubChem CID | 65362935 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (3,4-dimethylcyclohexyl)-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | CC1CCC(C(=O)c2ncn[nH]2)CC1C |
| InChI | InChI=1S/C11H17N3O/c1-7-3-4-9(5-8(7)2)10(15)11-12-6-13-14-11/h6-9H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | JUJOEORTLIEDHU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |