C13H17IOS — CID 114975513
(3,4-dimethylcyclohexyl)-(5-iodothiophen-3-yl)methanone (PubChem CID 114975513) has the molecular formula C13H17IOS and a molecular weight of 348.25 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl)-(5-iodothiophen-3-yl)methanone.
| Compound Name | (3,4-dimethylcyclohexyl)-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 114975513 |
| Molecular Formula | C13H17IOS |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | (3,4-dimethylcyclohexyl)-(5-iodothiophen-3-yl)methanone |
| SMILES | CC1CCC(C(=O)c2csc(I)c2)CC1C |
| InChI | InChI=1S/C13H17IOS/c1-8-3-4-10(5-9(8)2)13(15)11-6-12(14)16-7-11/h6-10H,3-5H2,1-2H3 |
| InChIKey | DHYGGEVZMRXVDO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|