C12H14INO3S — CID 79685648
3-[(5-iodothiophene-3-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 79685648) has the molecular formula C12H14INO3S and a molecular weight of 379.22 g/mol. Its IUPAC name is 3-[(5-iodothiophene-3-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[(5-iodothiophene-3-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79685648 |
| Molecular Formula | C12H14INO3S |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 3-[(5-iodothiophene-3-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1CCCC(C(=O)O)C1)c1csc(I)c1 |
| InChI | InChI=1S/C12H14INO3S/c13-10-5-8(6-18-10)11(15)14-9-3-1-2-7(4-9)12(16)17/h5-7,9H,1-4H2,(H,14,15)(H,16,17) |
| InChIKey | CAIMESHNCRWIRE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|