C6H9N5 — CID 163908268
N'-methyl-5-(methylideneamino)-1H-pyrazole-4-carboximidamide (PubChem CID 163908268) has the molecular formula C6H9N5 and a molecular weight of 151.17 g/mol. Its IUPAC name is N'-methyl-5-(methylideneamino)-1H-pyrazole-4-carboximidamide.
| Compound Name | N'-methyl-5-(methylideneamino)-1H-pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 163908268 |
| Molecular Formula | C6H9N5 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | N'-methyl-5-(methylideneamino)-1H-pyrazole-4-carboximidamide |
| SMILES | C=Nc1[nH]ncc1/C(N)=N/C |
| InChI | InChI=1S/C6H9N5/c1-8-5(7)4-3-10-11-6(4)9-2/h3H,2H2,1H3,(H2,7,8)(H,10,11) |
| InChIKey | QPWDXLCYNJJEIP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|