C3H7N4O2+ — CID 142371491
hydroxy-methoxy-(1H-1,2,4-triazol-5-yl)azanium (PubChem CID 142371491) has the molecular formula C3H7N4O2+ and a molecular weight of 131.12 g/mol. Its IUPAC name is hydroxy-methoxy-(1H-1,2,4-triazol-5-yl)azanium.
| Compound Name | hydroxy-methoxy-(1H-1,2,4-triazol-5-yl)azanium |
|---|---|
| PubChem CID | 142371491 |
| Molecular Formula | C3H7N4O2+ |
| Molecular Weight | 131.12 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | hydroxy-methoxy-(1H-1,2,4-triazol-5-yl)azanium |
| SMILES | CO[NH+](O)c1ncn[nH]1 |
| InChI | InChI=1S/C3H6N4O2/c1-9-7(8)3-4-2-5-6-3/h2,8H,1H3,(H,4,5,6)/p+1 |
| InChIKey | UOPJCWHHCSRCSE-UHFFFAOYSA-O |
| XLogP | -1.73 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.12 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|