About methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate
methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate (PubChem CID 171863476) has the molecular formula C6H9N3O4
and a molecular weight of 187.16 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate.
Analyze methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate?
The IUPAC name of methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate (CID 171863476) is methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate.
What is the SMILES notation for methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate?
The canonical SMILES for methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate is COC(=O)C(O)C(O)c1ncn[nH]1.
What is the InChIKey of methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate?
The InChIKey is AGCVIJCJXSCGDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O4/c1-13-6(12)4(11)3(10)5-7-2-8-9-5/h2-4,10-11H,1H3,(H,7,8,9).
What are the key properties of methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate?
methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate has a molecular weight of 187.16 g/mol, XLogP of -1.63, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-dihydroxy-3-(1H-1,2,4-triazol-5-yl)propanoate is sourced from PubChem (CID 171863476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).